CAS 1152527-60-0 is the registry number for 2–(tert–Butyl)benzo(d)oxazol–6–amine. Offered by: GLPBio. Available pack sizes: 25mg.
2-tert-butyl-1,3-benzoxazol-6-amine (CAS 1152527-60-0) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: 2-tert-butyl-1,3-benzoxazol-6-amine. InChIKey: VMMMPJQSGONHLP-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 2-tert-butyl-1,3-benzoxazol-6-amine |
| InChIKey | VMMMPJQSGONHLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=C(O1)C=C(C=C2)N |
Computed by PubChem (NCBI)