2-(tert-Butyl)phenyl trifluoromethanesulfonate, 98%
cas: 198206-03-0 — see every product listed under this CAS number, including other names
2-(tert-Butyl)phenyl trifluoromethanesulfonate, 98% (CAS 198206-03-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1722085-250mg |
| cas | 198206-03-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 403.75 Pln | |
| Ambeed | 1g | 993.38 Pln | |
| Ambeed | 5g | 3201.69 Pln | |
| Ambeed | 10g | 5081.81 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 592.40 Pln | |
| Chemat | 5g | 1974.80 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 1018.41 Pln | |
| Fluorochem | 5g | 3272.82 Pln | |
| BLDpharm | 250mg | 430.98 Pln | |
| BLDpharm | 1g | 1064.09 Pln | |
| BLDpharm | 5g | 3446.59 Pln | |
| BLDpharm | 10g | 5473.65 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2-tert-butylphenyl) trifluoromethanesulfonate (CAS 198206-03-0) is a chemical compound with the molecular formula C11H13F3O3S and a molecular weight of 282.28 g/mol. IUPAC name: (2-tert-butylphenyl) trifluoromethanesulfonate. InChIKey: AZQMAJJXUBCFCX-UHFFFAOYSA-N.
| Molecular formula | C11H13F3O3S |
|---|---|
| Molecular weight | 282.28 g/mol |
| IUPAC name | (2-tert-butylphenyl) trifluoromethanesulfonate |
| InChIKey | AZQMAJJXUBCFCX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC=C1OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)