cas: 110284-79-2 — see every product listed under this CAS number, including other names
2-[(4,6-Dimethoxypyrimidin-2-yl)thio]benzoic acid (CAS 110284-79-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023712-1G |
| cas | 110284-79-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1127.75 Pln | |
| Fluorochem | 5g | 2476.23 Pln |
| delivery time | 2-3 weeks |
|---|
2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid (CAS 110284-79-2) is a chemical compound with the molecular formula C13H12N2O4S and a molecular weight of 292.31 g/mol. IUPAC name: 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid. InChIKey: DFQPVZIMUBRHGM-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4S |
|---|---|
| Molecular weight | 292.31 g/mol |
| IUPAC name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbenzoic acid |
| InChIKey | DFQPVZIMUBRHGM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=N1)SC2=CC=CC=C2C(=O)O)OC |
Computed by PubChem (NCBI)