cas: 66056-40-4 — see every product listed under this CAS number, including other names
2-[2,4-Bis(benzyloxy)phenyl]acetic Acid, ≥95%, ≥95% (CAS 66056-40-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBJZ-250mg |
| cas | 66056-40-4 |
| size | 250mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 861.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-[2,4-bis(phenylmethoxy)phenyl]acetic acid (CAS 66056-40-4) is a chemical compound with the molecular formula C22H20O4 and a molecular weight of 348.4 g/mol. IUPAC name: 2-[2,4-bis(phenylmethoxy)phenyl]acetic acid. InChIKey: MJIBFVVTWAHLOE-UHFFFAOYSA-N.
| Molecular formula | C22H20O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 2-[2,4-bis(phenylmethoxy)phenyl]acetic acid |
| InChIKey | MJIBFVVTWAHLOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)CC(=O)O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)