cas: 287944-06-3 — see every product listed under this CAS number, including other names
2-[4-(1,1-Dimethylethyl)-1-cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97% (CAS 287944-06-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113WHN-100mg |
| cas | 287944-06-3 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 218.00 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 10g | 1158.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4-tert-butylcyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 287944-06-3) is a chemical compound with the molecular formula C16H29BO2 and a molecular weight of 264.2 g/mol. IUPAC name: 2-(4-tert-butylcyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GTRURWFRLWPOBJ-UHFFFAOYSA-N.
| Molecular formula | C16H29BO2 |
|---|---|
| Molecular weight | 264.2 g/mol |
| IUPAC name | 2-(4-tert-butylcyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GTRURWFRLWPOBJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)C(C)(C)C |
Computed by PubChem (NCBI)