cas: 849021-42-7 — see every product listed under this CAS number, including other names
2-[4-(5-Bromopyrimidin-2-yl)piperazin-1-yl]ethanol (CAS 849021-42-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023586-250MG |
| cas | 849021-42-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 5g | 1611.95 Pln |
| delivery time | 2-3 weeks |
|---|
2-[4-(5-bromopyrimidin-2-yl)piperazin-1-yl]ethanol (CAS 849021-42-7) is a chemical compound with the molecular formula C10H15BrN4O and a molecular weight of 287.16 g/mol. IUPAC name: 2-[4-(5-bromopyrimidin-2-yl)piperazin-1-yl]ethanol. InChIKey: ZZAGRUBMUDIADL-UHFFFAOYSA-N.
| Molecular formula | C10H15BrN4O |
|---|---|
| Molecular weight | 287.16 g/mol |
| IUPAC name | 2-[4-(5-bromopyrimidin-2-yl)piperazin-1-yl]ethanol |
| InChIKey | ZZAGRUBMUDIADL-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CCO)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)