cas: 914347-48-1 — see every product listed under this CAS number, including other names
2-[4-(6-Amino-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol 95% (CAS 914347-48-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139956-100mg |
| cas | 914347-48-1 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1249.25 Pln | |
| Ambeed | 10g | 1955.69 Pln | |
| Ambeed | 25g | 3579.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A139956 |
2-[4-(6-amino-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol (CAS 914347-48-1) is a chemical compound with the molecular formula C11H19N5O and a molecular weight of 237.30 g/mol. IUPAC name: 2-[4-(6-amino-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol. InChIKey: WTWUJVVJDKVQBS-UHFFFAOYSA-N.
| Molecular formula | C11H19N5O |
|---|---|
| Molecular weight | 237.30 g/mol |
| IUPAC name | 2-[4-(6-amino-2-methylpyrimidin-4-yl)piperazin-1-yl]ethanol |
| InChIKey | WTWUJVVJDKVQBS-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC(=N1)N2CCN(CC2)CCO)N |
Computed by PubChem (NCBI)