cas: 921937-76-0 — see every product listed under this CAS number, including other names
2-[4-(Hexyloxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95+%, 95+% (CAS 921937-76-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1173VP-100mg |
| cas | 921937-76-0 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 789.20 Pln | |
| Chemat | 5g | 2973.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-(4-hexoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 921937-76-0) is a chemical compound with the molecular formula C18H29BO3 and a molecular weight of 304.2 g/mol. IUPAC name: 2-(4-hexoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: TXGAKSQNBPROMR-UHFFFAOYSA-N.
| Molecular formula | C18H29BO3 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 2-(4-hexoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | TXGAKSQNBPROMR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCCCCC |
Computed by PubChem (NCBI)