2-(9,9-Spirobifluoren-2-yl)-9,9-spirobifluorene, 99% (CAS 664345-18-0) manufactured by Lumtec in a 5g pack.
| brand | Lumtec |
|---|---|
| catalog number | LT-E411-5g |
| cas | 664345-18-0 |
| size | 5g |
| availability | 12.11.2021: In Stock |
Ask us about this product — we're happy to help.
| purity | 99% |
|---|
2-(9,9'-spirobi[fluorene]-2-yl)-9,9'-spirobi[fluorene] (CAS 664345-18-0) is a chemical compound with the molecular formula C50H30 and a molecular weight of 630.8 g/mol. IUPAC name: 2-(9,9'-spirobi[fluorene]-2-yl)-9,9'-spirobi[fluorene]. InChIKey: RASFLGVDOLMZBD-UHFFFAOYSA-N.
| Molecular formula | C50H30 |
|---|---|
| Molecular weight | 630.8 g/mol |
| IUPAC name | 2-(9,9'-spirobi[fluorene]-2-yl)-9,9'-spirobi[fluorene] |
| InChIKey | RASFLGVDOLMZBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(C24C5=CC=CC=C5C6=CC=CC=C46)C=C(C=C3)C7=CC8=C(C=C7)C9=CC=CC=C9C81C2=CC=CC=C2C2=CC=CC=C12 |
Computed by PubChem (NCBI)