cas: 901184-30-3 — see every product listed under this CAS number, including other names
2-AMINO-4-(2,5-DICHLOROPHENYL)-3-THIOPHENECARBONITRILE, 95%, 95% (CAS 901184-30-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IG22-100mg |
| cas | 901184-30-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-4-(2,5-dichlorophenyl)thiophene-3-carbonitrile (CAS 901184-30-3) is a chemical compound with the molecular formula C11H6Cl2N2S and a molecular weight of 269.1 g/mol. IUPAC name: 2-amino-4-(2,5-dichlorophenyl)thiophene-3-carbonitrile. InChIKey: JTUYPUFMYQJTIR-UHFFFAOYSA-N.
| Molecular formula | C11H6Cl2N2S |
|---|---|
| Molecular weight | 269.1 g/mol |
| IUPAC name | 2-amino-4-(2,5-dichlorophenyl)thiophene-3-carbonitrile |
| InChIKey | JTUYPUFMYQJTIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C2=CSC(=C2C#N)N)Cl |
Computed by PubChem (NCBI)