cas: 24106-05-6 — see every product listed under this CAS number, including other names
2-Acetamido-5-bromotoluene, 98% (CAS 24106-05-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F035757-10G |
| cas | 24106-05-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 247.85 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 284.29 Pln | |
| Fluorochem | 100g | 789.32 Pln | |
| Fluorochem | 500g | 2778.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-(4-bromo-2-methylphenyl)acetamide (CAS 24106-05-6) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: N-(4-bromo-2-methylphenyl)acetamide. InChIKey: IJZSFOIZVXCSFP-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | N-(4-bromo-2-methylphenyl)acetamide |
| InChIKey | IJZSFOIZVXCSFP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)NC(=O)C |
Computed by PubChem (NCBI)