2-Amino-1H-indole-3-carbonitrile, 95%
cas: 131816-47-2 — see every product listed under this CAS number, including other names
2-Amino-1H-indole-3-carbonitrile, 95% (CAS 131816-47-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1071321-100mg |
| cas | 131816-47-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1288.19 Pln | |
| Ambeed | 250mg | 2139.25 Pln | |
| Ambeed | 1g | 4853.75 Pln | |
| BLDpharm | 50mg | 775.31 Pln | |
| BLDpharm | 100mg | 1269.58 Pln | |
| BLDpharm | 250mg | 2097.06 Pln | |
| BLDpharm | 1g | 5534.74 Pln | |
| Chemat | 50mg | 832.40 Pln | |
| Chemat | 100mg | 1365.20 Pln | |
| Chemat | 250mg | 2277.20 Pln | |
| Chemat | 1g | 6040.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-amino-1H-indole-3-carbonitrile (CAS 131816-47-2) is a chemical compound with the molecular formula C9H7N3 and a molecular weight of 157.17 g/mol. IUPAC name: 2-amino-1H-indole-3-carbonitrile. InChIKey: VUJHHCISRCAVOU-UHFFFAOYSA-N.
| Molecular formula | C9H7N3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | 2-amino-1H-indole-3-carbonitrile |
| InChIKey | VUJHHCISRCAVOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)N)C#N |
Computed by PubChem (NCBI)