2-Amino-2-(4-(heptyloxy)-3-(trifluoromethyl)phenethyl)propane-1,3-diol hydrochloride, 98%
cas: 942398-84-7 — see every product listed under this CAS number, including other names
2-Amino-2-(4-(heptyloxy)-3-(trifluoromethyl)phenethyl)propane-1,3-diol hydrochloride, 98% (CAS 942398-84-7) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD764620-10mg |
| cas | 942398-84-7 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 10mg | 425.43 Pln | |
| BLDpharm | 25mg | 675.34 Pln | |
| BLDpharm | 50mg | 1064.09 Pln | |
| BLDpharm | 100mg | 1730.53 Pln | |
| BLDpharm | 250mg | 3257.77 Pln | |
| BLDpharm | 1g | 9133.48 Pln | |
| Chemat | 10mg | 390.80 Pln | |
| Chemat | 25mg | 626.00 Pln | |
| Chemat | 50mg | 986.00 Pln | |
| Chemat | 100mg | 1614.80 Pln | |
| Chemat | 250mg | 3040.40 Pln | |
| Chemat | 1g | 8522.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-2-[2-[4-heptoxy-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol;hydrochloride (CAS 942398-84-7) is a chemical compound with the molecular formula C19H31ClF3NO3 and a molecular weight of 413.9 g/mol. IUPAC name: 2-amino-2-[2-[4-heptoxy-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol;hydrochloride. InChIKey: GEDVJGOVRLHFQG-UHFFFAOYSA-N.
| Molecular formula | C19H31ClF3NO3 |
|---|---|
| Molecular weight | 413.9 g/mol |
| IUPAC name | 2-amino-2-[2-[4-heptoxy-3-(trifluoromethyl)phenyl]ethyl]propane-1,3-diol;hydrochloride |
| InChIKey | GEDVJGOVRLHFQG-UHFFFAOYSA-N |
| SMILES | CCCCCCCOC1=C(C=C(C=C1)CCC(CO)(CO)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)