cas: 133622-66-9 — see every product listed under this CAS number, including other names
2-Amino-3,5,6-trifluoro-1,4-benzenedicarbonitrile, 97%, 97% (CAS 133622-66-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118N99-250mg |
| cas | 133622-66-9 |
| size | 250mg |
| availability | 3.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 1g | 1029.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-3,5,6-trifluorobenzene-1,4-dicarbonitrile (CAS 133622-66-9) is a chemical compound with the molecular formula C8H2F3N3 and a molecular weight of 197.12 g/mol. IUPAC name: 2-amino-3,5,6-trifluorobenzene-1,4-dicarbonitrile. InChIKey: JJQQOCSLHWPLLT-UHFFFAOYSA-N.
| Molecular formula | C8H2F3N3 |
|---|---|
| Molecular weight | 197.12 g/mol |
| IUPAC name | 2-amino-3,5,6-trifluorobenzene-1,4-dicarbonitrile |
| InChIKey | JJQQOCSLHWPLLT-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(C(=C(C(=C1F)F)C#N)F)N |
Computed by PubChem (NCBI)