cas: 914636-84-3 — see every product listed under this CAS number, including other names
2-Amino-3-bromo-5-chlorobenzonitrile, 98% (CAS 914636-84-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F035126-1G |
| cas | 914636-84-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 768.50 Pln | |
| Fluorochem | 25g | 2169.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-amino-3-bromo-5-chlorobenzonitrile (CAS 914636-84-3) is a chemical compound with the molecular formula C7H4BrClN2 and a molecular weight of 231.48 g/mol. IUPAC name: 2-amino-3-bromo-5-chlorobenzonitrile. InChIKey: BWYLAELWYGJTEX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2 |
|---|---|
| Molecular weight | 231.48 g/mol |
| IUPAC name | 2-amino-3-bromo-5-chlorobenzonitrile |
| InChIKey | BWYLAELWYGJTEX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C#N)N)Br)Cl |
Computed by PubChem (NCBI)