cas: 5503-73-1 — see every product listed under this CAS number, including other names
2-Amino-4,5-diphenylfuran-3-carbonitrile 98% (CAS 5503-73-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A836903-250mg |
| cas | 5503-73-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 832.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A836903 |
2-amino-4,5-diphenylfuran-3-carbonitrile (CAS 5503-73-1) is a chemical compound with the molecular formula C17H12N2O and a molecular weight of 260.29 g/mol. IUPAC name: 2-amino-4,5-diphenylfuran-3-carbonitrile. InChIKey: BPFMLOQVCKVCAT-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 2-amino-4,5-diphenylfuran-3-carbonitrile |
| InChIKey | BPFMLOQVCKVCAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(OC(=C2C#N)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)