cas: 1199-46-8 — see every product listed under this CAS number, including other names
2-Amino-4-(tert-butyl)phenol, 98%, 98% (CAS 1199-46-8) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5g, 10g, 25g, 50g, 100g, 200g, 300g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PUX-1kg |
| cas | 1199-46-8 |
| size | 1kg |
| availability | 3000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 578.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 88.40 Pln | |
| Chemat | 50g | 112.40 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 200g | 165.20 Pln | |
| Chemat | 300g | 213.20 Pln | |
| Chemat | 400g | 261.20 Pln | |
| Chemat | 500g | 360.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-4-tert-butylphenol (CAS 1199-46-8) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: 2-amino-4-tert-butylphenol. InChIKey: RPJUVNYXHUCRMG-UHFFFAOYSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 165.23 g/mol |
| IUPAC name | 2-amino-4-tert-butylphenol |
| InChIKey | RPJUVNYXHUCRMG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)O)N |
Computed by PubChem (NCBI)