cas: 1007-99-4 — see every product listed under this CAS number, including other names
2-Amino-4-chloro-6-hydroxy-5-nitropyrimidine 90% (CAS 1007-99-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A121287-100mg |
| cas | 1007-99-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 392.62 Pln | |
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1594.12 Pln |
| purity | 90% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A121287 |
2-amino-4-chloro-5-nitro-1H-pyrimidin-6-one (CAS 1007-99-4) is a chemical compound with the molecular formula C4H3ClN4O3 and a molecular weight of 190.54 g/mol. IUPAC name: 2-amino-4-chloro-5-nitro-1H-pyrimidin-6-one. InChIKey: UTTPUMOOQSNOHH-UHFFFAOYSA-N.
| Molecular formula | C4H3ClN4O3 |
|---|---|
| Molecular weight | 190.54 g/mol |
| IUPAC name | 2-amino-4-chloro-5-nitro-1H-pyrimidin-6-one |
| InChIKey | UTTPUMOOQSNOHH-UHFFFAOYSA-N |
| SMILES | C1(=C(N=C(NC1=O)N)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)