cas: 393-49-7 — see every product listed under this CAS number, including other names
2-Amino-4-nitrobenzotrifluoride 98% (CAS 393-49-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A567048-10g |
| cas | 393-49-7 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 3151.62 Pln | |
| Ambeed | 250mg | 264.69 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 1994.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A567048 |
5-nitro-2-(trifluoromethyl)aniline (CAS 393-49-7) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: 5-nitro-2-(trifluoromethyl)aniline. InChIKey: LGHXDTHJGNCRKT-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 5-nitro-2-(trifluoromethyl)aniline |
| InChIKey | LGHXDTHJGNCRKT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])N)C(F)(F)F |
Computed by PubChem (NCBI)