cas: 1256359-27-9 — see every product listed under this CAS number, including other names
2-Amino-4-trifluoromethoxyphenylboronic acid pinacol ester, 95%, 95% (CAS 1256359-27-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O87-100mg |
| cas | 1256359-27-9 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 582.80 Pln | |
| Chemat | 250mg | 933.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)aniline (CAS 1256359-27-9) is a chemical compound with the molecular formula C13H17BF3NO3 and a molecular weight of 303.09 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)aniline. InChIKey: AEAKBFSIFAZERW-UHFFFAOYSA-N.
| Molecular formula | C13H17BF3NO3 |
|---|---|
| Molecular weight | 303.09 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethoxy)aniline |
| InChIKey | AEAKBFSIFAZERW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC(F)(F)F)N |
Computed by PubChem (NCBI)