cas: 1227586-78-8 — see every product listed under this CAS number, including other names
2-Amino-5-(trifluoromethyl)pyridin-3-ol, 95% (CAS 1227586-78-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 10g, 5g. Offered by: Combi-blocks, AmBeed, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | HB-5693-1g |
| cas | 1227586-78-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 250mg | price on request | |
| AmBeed | 100mg | 629.86 Pln | |
| AmBeed | 10g | 12744.97 Pln | |
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 1g | 1424.52 Pln | |
| Fluorochem | 5g | 4720.23 Pln | |
| Fluorochem | 10g | 7943.05 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-amino-5-(trifluoromethyl)pyridin-3-ol (CAS 1227586-78-8) is a chemical compound with the molecular formula C6H5F3N2O and a molecular weight of 178.11 g/mol. IUPAC name: 2-amino-5-(trifluoromethyl)pyridin-3-ol. InChIKey: NMUNUKLWMJMWMC-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 2-amino-5-(trifluoromethyl)pyridin-3-ol |
| InChIKey | NMUNUKLWMJMWMC-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1O)N)C(F)(F)F |
Computed by PubChem (NCBI)