cas: 1029-52-3 — see every product listed under this CAS number, including other names
2-Amino-6-benzyl-5,6,7,8-tetrahydropyrido(4,3-d)pyrimidin-4(3H)-one, 95+% (CAS 1029-52-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A568697-5g |
| cas | 1029-52-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 12425.98 Pln | |
| AmBeed | 10g | 19788.79 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-6-benzyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (CAS 1029-52-3) is a chemical compound with the molecular formula C14H16N4O and a molecular weight of 256.30 g/mol. IUPAC name: 2-amino-6-benzyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one. InChIKey: LLTVQQOAWCNPMD-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | 2-amino-6-benzyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| InChIKey | LLTVQQOAWCNPMD-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1N=C(NC2=O)N)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)