cas: 23662-75-1 — see every product listed under this CAS number, including other names
2-Amino-8-methyl-1H-purin-6(9H)-one 97% (CAS 23662-75-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A465460-100mg |
| cas | 23662-75-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 320.31 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1638.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A465460 |
2-amino-8-methyl-1,7-dihydropurin-6-one (CAS 23662-75-1) is a chemical compound with the molecular formula C6H7N5O and a molecular weight of 165.15 g/mol. IUPAC name: 2-amino-8-methyl-1,7-dihydropurin-6-one. InChIKey: DJGMEMUXTWZGIC-UHFFFAOYSA-N.
| Molecular formula | C6H7N5O |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-amino-8-methyl-1,7-dihydropurin-6-one |
| InChIKey | DJGMEMUXTWZGIC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)