cas: 57947-01-0 — see every product listed under this CAS number, including other names
2-Amino-N,N-diethylbenzenesulfonamide, 98%, 98% (CAS 57947-01-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EKLP-10g |
| cas | 57947-01-0 |
| size | 10g |
| availability | 10.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1029.20 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 544.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-N,N-diethylbenzenesulfonamide (CAS 57947-01-0) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 228.31 g/mol. IUPAC name: 2-amino-N,N-diethylbenzenesulfonamide. InChIKey: FWNGNMWNTIIKRE-UHFFFAOYSA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | 2-amino-N,N-diethylbenzenesulfonamide |
| InChIKey | FWNGNMWNTIIKRE-UHFFFAOYSA-N |
| SMILES | CCN(CC)S(=O)(=O)C1=CC=CC=C1N |
Computed by PubChem (NCBI)