cas: 18330-76-2 — see every product listed under this CAS number, including other names
2-Aminobenzothiazole-6-carboxylic Acid Hydrochloride 98% (CAS 18330-76-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A617108-250mg |
| cas | 18330-76-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 270.25 Pln | |
| Ambeed | 25g | 960.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A617108 |
2-amino-1,3-benzothiazole-6-carboxylic acid;hydrochloride (CAS 18330-76-2) is a chemical compound with the molecular formula C8H7ClN2O2S and a molecular weight of 230.67 g/mol. IUPAC name: 2-amino-1,3-benzothiazole-6-carboxylic acid;hydrochloride. InChIKey: UTKWPETXSJOITB-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O2S |
|---|---|
| Molecular weight | 230.67 g/mol |
| IUPAC name | 2-amino-1,3-benzothiazole-6-carboxylic acid;hydrochloride |
| InChIKey | UTKWPETXSJOITB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)SC(=N2)N.Cl |
Computed by PubChem (NCBI)