cas: 2121514-56-3 — see every product listed under this CAS number, including other names
2-Aminopyridine-5-boronic acid pinacol ester hydrochloride (CAS 2121514-56-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627405-1G |
| cas | 2121514-56-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1325.59 Pln | |
| Fluorochem | 5g | 3840.33 Pln |
| delivery time | 3-4 weeks |
|---|
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine;hydrochloride (CAS 2121514-56-3) is a chemical compound with the molecular formula C11H18BClN2O2 and a molecular weight of 256.54 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine;hydrochloride. InChIKey: JEGMQTQCFUZZAD-UHFFFAOYSA-N.
| Molecular formula | C11H18BClN2O2 |
|---|---|
| Molecular weight | 256.54 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine;hydrochloride |
| InChIKey | JEGMQTQCFUZZAD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)N.Cl |
Computed by PubChem (NCBI)