cas: 159326-75-7 — see every product listed under this CAS number, including other names
2-Aminopyrrolo(2,1-f)(1,2,4)triazin-4(3H)-one, 98% (CAS 159326-75-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A788995-5g |
| cas | 159326-75-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 11918.20 Pln | |
| AmBeed | 100mg | 2693.53 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (CAS 159326-75-7) is a chemical compound with the molecular formula C6H6N4O and a molecular weight of 150.14 g/mol. IUPAC name: 2-amino-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one. InChIKey: GOZHMTPUHBNEJV-UHFFFAOYSA-N.
| Molecular formula | C6H6N4O |
|---|---|
| Molecular weight | 150.14 g/mol |
| IUPAC name | 2-amino-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| InChIKey | GOZHMTPUHBNEJV-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)