CAS 706806-60-2 appears in our catalog under these names: (R)–2–Benzyl–1–(tert–butoxycarbonyl)pyrrolidine–2–carboxylic acid, (R)-2-Benzyl-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid, 97%, (R)-2-Benzyl-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid, 95%, 95%, 2-Benzyl-N-Boc-L-proline, 95% . Offered by: GLPBio, Fluorochem, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 100mg, 1g, 250mg, 5g.
(2R)-2-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 706806-60-2) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: (2R)-2-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: JUUNPRGYFCIXSM-QGZVFWFLSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | (2R)-2-benzyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | JUUNPRGYFCIXSM-QGZVFWFLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@]1(CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)