cas: 1377962-47-4 — see every product listed under this CAS number, including other names
2-Bromo-1-(2-methyl-6-(trifluoromethyl)pyridin-3-yl)ethan-1-one hydrobromide, 90% (CAS 1377962-47-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A943752-10g |
| cas | 1377962-47-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19281.01 Pln | |
| AmBeed | 5g | 11410.42 Pln |
| purity | 90% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-1-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]ethanone;hydrobromide (CAS 1377962-47-4) is a chemical compound with the molecular formula C9H8Br2F3NO and a molecular weight of 362.97 g/mol. IUPAC name: 2-bromo-1-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]ethanone;hydrobromide. InChIKey: UTXLHDAICREEBA-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2F3NO |
|---|---|
| Molecular weight | 362.97 g/mol |
| IUPAC name | 2-bromo-1-[2-methyl-6-(trifluoromethyl)-3-pyridinyl]ethanone;hydrobromide |
| InChIKey | UTXLHDAICREEBA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C(F)(F)F)C(=O)CBr.Br |
Computed by PubChem (NCBI)