cas: 63529-31-7 — see every product listed under this CAS number, including other names
2-Bromo-1-(4-fluoro-3-methylphenyl)ethanone 97% (CAS 63529-31-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A602948-250mg |
| cas | 63529-31-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 604.00 Pln | |
| Ambeed | 1g | 1060.12 Pln | |
| Ambeed | 5g | 3535.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A602948 |
2-bromo-1-(4-fluoro-3-methylphenyl)ethanone (CAS 63529-31-7) is a chemical compound with the molecular formula C9H8BrFO and a molecular weight of 231.06 g/mol. IUPAC name: 2-bromo-1-(4-fluoro-3-methylphenyl)ethanone. InChIKey: PFWAGSRBBGFIOF-UHFFFAOYSA-N.
| Molecular formula | C9H8BrFO |
|---|---|
| Molecular weight | 231.06 g/mol |
| IUPAC name | 2-bromo-1-(4-fluoro-3-methylphenyl)ethanone |
| InChIKey | PFWAGSRBBGFIOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)CBr)F |
Computed by PubChem (NCBI)