cas: 1038734-55-2 — see every product listed under this CAS number, including other names
2-Bromo-1-(hexyloxy)-4-methylbenzene, ≥97-<99% (CAS 1038734-55-2) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC2033-97-99-2.5g |
| cas | 1038734-55-2 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 5329.06 Pln | |
| Hoffman Fine Chemicals | 5g | 8334.04 Pln | |
| Hoffman Fine Chemicals | 10g | 13125.42 Pln | |
| Hoffman Fine Chemicals | 25g | 25936.46 Pln | |
| Hoffman Fine Chemicals | 50g | 41312.26 Pln |
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-bromo-1-hexoxy-4-methylbenzene (CAS 1038734-55-2) is a chemical compound with the molecular formula C13H19BrO and a molecular weight of 271.19 g/mol. IUPAC name: 2-bromo-1-hexoxy-4-methylbenzene. InChIKey: FBPIRSDZZMDDGA-UHFFFAOYSA-N.
| Molecular formula | C13H19BrO |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | 2-bromo-1-hexoxy-4-methylbenzene |
| InChIKey | FBPIRSDZZMDDGA-UHFFFAOYSA-N |
| SMILES | CCCCCCOC1=C(C=C(C=C1)C)Br |
Computed by PubChem (NCBI)