cas: 116529-60-3 — see every product listed under this CAS number, including other names
2-Bromo-3,5-dinitrobenzoic acid 98% (CAS 116529-60-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A215206-10g |
| cas | 116529-60-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 203.50 Pln | |
| Ambeed | 25g | 286.94 Pln | |
| Ambeed | 100g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A215206 |
2-bromo-3,5-dinitrobenzoic acid (CAS 116529-60-3) is a chemical compound with the molecular formula C7H3BrN2O6 and a molecular weight of 291.01 g/mol. IUPAC name: 2-bromo-3,5-dinitrobenzoic acid. InChIKey: BBKJKUFARRJPRP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN2O6 |
|---|---|
| Molecular weight | 291.01 g/mol |
| IUPAC name | 2-bromo-3,5-dinitrobenzoic acid |
| InChIKey | BBKJKUFARRJPRP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)Br)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)