CAS 1805028-82-3 is the registry number for 2–Bromo–3–nitro–6–(trifluoromethyl)pyridine. Offered by: GLPBio. Available pack sizes: 100mg.
2-bromo-3-nitro-6-(trifluoromethyl)pyridine (CAS 1805028-82-3) is a chemical compound with the molecular formula C6H2BrF3N2O2 and a molecular weight of 270.99 g/mol. IUPAC name: 2-bromo-3-nitro-6-(trifluoromethyl)pyridine. InChIKey: CIRFMPZJWYRUBA-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF3N2O2 |
|---|---|
| Molecular weight | 270.99 g/mol |
| IUPAC name | 2-bromo-3-nitro-6-(trifluoromethyl)pyridine |
| InChIKey | CIRFMPZJWYRUBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])Br)C(F)(F)F |
Computed by PubChem (NCBI)