cas: 372120-77-9 — see every product listed under this CAS number, including other names
2-Bromo-4-(bromomethyl)-1-(trifluoromethyl)benzene 97% (CAS 372120-77-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A744018-100mg |
| cas | 372120-77-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1249.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A744018 |
2-bromo-4-(bromomethyl)-1-(trifluoromethyl)benzene (CAS 372120-77-9) is a chemical compound with the molecular formula C8H5Br2F3 and a molecular weight of 317.93 g/mol. IUPAC name: 2-bromo-4-(bromomethyl)-1-(trifluoromethyl)benzene. InChIKey: LILRRORFROBNDB-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2F3 |
|---|---|
| Molecular weight | 317.93 g/mol |
| IUPAC name | 2-bromo-4-(bromomethyl)-1-(trifluoromethyl)benzene |
| InChIKey | LILRRORFROBNDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CBr)Br)C(F)(F)F |
Computed by PubChem (NCBI)