cas: 34252-94-3 — see every product listed under this CAS number, including other names
2-Bromo-4-(tert-butyl)-1-fluorobenzene 97% (CAS 34252-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A828059-100mg |
| cas | 34252-94-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 214.62 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 726.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A828059 |
2-bromo-4-tert-butyl-1-fluorobenzene (CAS 34252-94-3) is a chemical compound with the molecular formula C10H12BrF and a molecular weight of 231.10 g/mol. IUPAC name: 2-bromo-4-tert-butyl-1-fluorobenzene. InChIKey: ADCKDGLOIVDKBH-UHFFFAOYSA-N.
| Molecular formula | C10H12BrF |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 2-bromo-4-tert-butyl-1-fluorobenzene |
| InChIKey | ADCKDGLOIVDKBH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)F)Br |
Computed by PubChem (NCBI)