cas: 1244949-24-3 — see every product listed under this CAS number, including other names
2-Bromo-4-chloro-6-(trifluoromethoxy)aniline, 97% (CAS 1244949-24-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 25g, 10g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A198360-1g |
| cas | 1244949-24-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 486.64 Pln | |
| AmBeed | 250mg | 415.03 Pln | |
| AmBeed | 25g | 7204.96 Pln | |
| AmBeed | 10g | 3461.71 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 877.83 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-bromo-4-chloro-6-(trifluoromethoxy)aniline (CAS 1244949-24-3) is a chemical compound with the molecular formula C7H4BrClF3NO and a molecular weight of 290.46 g/mol. IUPAC name: 2-bromo-4-chloro-6-(trifluoromethoxy)aniline. InChIKey: WYCAACPCJVGVOP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3NO |
|---|---|
| Molecular weight | 290.46 g/mol |
| IUPAC name | 2-bromo-4-chloro-6-(trifluoromethoxy)aniline |
| InChIKey | WYCAACPCJVGVOP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1OC(F)(F)F)N)Br)Cl |
Computed by PubChem (NCBI)