2-Bromo-4-chloro-6-nitrophenol, 97%
cas: 15969-10-5 — see every product listed under this CAS number, including other names
2-Bromo-4-chloro-6-nitrophenol, 97% (CAS 15969-10-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A123258-250mg |
| cas | 15969-10-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 25g | 915.50 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 261.20 Pln | |
| Chemat | 10g | 458.00 Pln | |
| Chemat | 25g | 698.00 Pln | |
| Chemat | 100g | 2162.00 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| BLDpharm | 25g | 980.79 Pln | |
| Fluorochem | 1g | 148.92 Pln | |
| Fluorochem | 5g | 211.40 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 643.54 Pln | |
| Fluorochem | 100g | 2356.48 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-4-chloro-6-nitrophenol (CAS 15969-10-5) is a chemical compound with the molecular formula C6H3BrClNO3 and a molecular weight of 252.45 g/mol. IUPAC name: 2-bromo-4-chloro-6-nitrophenol. InChIKey: POBOBTAMSJHELX-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClNO3 |
|---|---|
| Molecular weight | 252.45 g/mol |
| IUPAC name | 2-bromo-4-chloro-6-nitrophenol |
| InChIKey | POBOBTAMSJHELX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])O)Br)Cl |
Computed by PubChem (NCBI)