2-Bromo-4-cyclopropylbenzonitrile, 97%
cas: 1237130-18-5 — see every product listed under this CAS number, including other names
2-Bromo-4-cyclopropylbenzonitrile, 97% (CAS 1237130-18-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A671493-100mg |
| cas | 1237130-18-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 487.19 Pln | |
| Ambeed | 250mg | 809.81 Pln | |
| Ambeed | 1g | 2078.06 Pln | |
| BLDpharm | 100mg | 519.84 Pln | |
| BLDpharm | 250mg | 869.72 Pln | |
| BLDpharm | 1g | 2235.90 Pln | |
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 582.80 Pln | |
| Chemat | 1g | 2133.20 Pln | |
| Fluorochem | 100mg | 497.76 Pln | |
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 1g | 2132.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-4-cyclopropylbenzonitrile (CAS 1237130-18-5) is a chemical compound with the molecular formula C10H8BrN and a molecular weight of 222.08 g/mol. IUPAC name: 2-bromo-4-cyclopropylbenzonitrile. InChIKey: VQNMIDBWDLAFFR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN |
|---|---|
| Molecular weight | 222.08 g/mol |
| IUPAC name | 2-bromo-4-cyclopropylbenzonitrile |
| InChIKey | VQNMIDBWDLAFFR-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=C(C=C2)C#N)Br |
Computed by PubChem (NCBI)