cas: 2379321-92-1 — see every product listed under this CAS number, including other names
2-Bromo-4-fluoro-3-isopropoxy-1-methylbenzene, 98% (CAS 2379321-92-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1707135-25g |
| cas | 2379321-92-1 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 24020.29 Pln | |
| AmBeed | 5g | 7263.55 Pln | |
| AmBeed | 10g | 12256.72 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-bromo-1-fluoro-4-methyl-2-propan-2-yloxybenzene (CAS 2379321-92-1) is a chemical compound with the molecular formula C10H12BrFO and a molecular weight of 247.10 g/mol. IUPAC name: 3-bromo-1-fluoro-4-methyl-2-propan-2-yloxybenzene. InChIKey: YYTXUPKXXQFFGY-UHFFFAOYSA-N.
| Molecular formula | C10H12BrFO |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | 3-bromo-1-fluoro-4-methyl-2-propan-2-yloxybenzene |
| InChIKey | YYTXUPKXXQFFGY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)OC(C)C)Br |
Computed by PubChem (NCBI)