CAS 2260959-41-7 appears in our catalog under these names: 2-Bromo-4-fluoro-6-isopropylaniline, 98%, 2-Bromo-4-fluoro-6-isopropylaniline, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
2-bromo-4-fluoro-6-propan-2-ylaniline (CAS 2260959-41-7) is a chemical compound with the molecular formula C9H11BrFN and a molecular weight of 232.09 g/mol. IUPAC name: 2-bromo-4-fluoro-6-propan-2-ylaniline. InChIKey: ZLLFSDAAWDEART-UHFFFAOYSA-N.
| Molecular formula | C9H11BrFN |
|---|---|
| Molecular weight | 232.09 g/mol |
| IUPAC name | 2-bromo-4-fluoro-6-propan-2-ylaniline |
| InChIKey | ZLLFSDAAWDEART-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=CC(=C1)F)Br)N |
Computed by PubChem (NCBI)