cas: 343262-51-1 — see every product listed under this CAS number, including other names
2-Bromo-5-(methylsulfonyl)pyridine, 97% (CAS 343262-51-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093591-1G |
| cas | 343262-51-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 2.5g | 508.17 Pln | |
| Fluorochem | 5g | 685.19 Pln | |
| Fluorochem | 10g | 1299.56 Pln | |
| Fluorochem | 25g | 3168.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-5-methylsulfonylpyridine (CAS 343262-51-1) is a chemical compound with the molecular formula C6H6BrNO2S and a molecular weight of 236.09 g/mol. IUPAC name: 2-bromo-5-methylsulfonylpyridine. InChIKey: ZRXQHWYUAIXKRL-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO2S |
|---|---|
| Molecular weight | 236.09 g/mol |
| IUPAC name | 2-bromo-5-methylsulfonylpyridine |
| InChIKey | ZRXQHWYUAIXKRL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CN=C(C=C1)Br |
Computed by PubChem (NCBI)