cas: 1245807-64-0 — see every product listed under this CAS number, including other names
2-Bromo-5-fluoroterephthalic acid, 97%, 97% (CAS 1245807-64-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ME8-100mg |
| cas | 1245807-64-0 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 688.40 Pln | |
| Chemat | 5g | 2032.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-5-fluoroterephthalic acid (CAS 1245807-64-0) is a chemical compound with the molecular formula C8H4BrFO4 and a molecular weight of 263.02 g/mol. IUPAC name: 2-bromo-5-fluoroterephthalic acid. InChIKey: NOWJAVVCARLMRF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrFO4 |
|---|---|
| Molecular weight | 263.02 g/mol |
| IUPAC name | 2-bromo-5-fluoroterephthalic acid |
| InChIKey | NOWJAVVCARLMRF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)C(=O)O)Br)C(=O)O |
Computed by PubChem (NCBI)