2-Bromo-6-(tert-butyl)phenol, 95%
cas: 23159-87-7 — see every product listed under this CAS number, including other names
2-Bromo-6-(tert-butyl)phenol, 95% (CAS 23159-87-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1184706-100mg |
| cas | 23159-87-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1927.88 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 606.80 Pln | |
| Chemat | 5g | 2118.80 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 480.97 Pln | |
| BLDpharm | 5g | 2074.85 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-6-tert-butylphenol (CAS 23159-87-7) is a chemical compound with the molecular formula C10H13BrO and a molecular weight of 229.11 g/mol. IUPAC name: 2-bromo-6-tert-butylphenol. InChIKey: AXYXIQJROSLHJZ-UHFFFAOYSA-N.
| Molecular formula | C10H13BrO |
|---|---|
| Molecular weight | 229.11 g/mol |
| IUPAC name | 2-bromo-6-tert-butylphenol |
| InChIKey | AXYXIQJROSLHJZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC=C1)Br)O |
Computed by PubChem (NCBI)