cas: 875664-36-1 — see every product listed under this CAS number, including other names
2-Bromo-6-fluoro-4-nitroanisole, 98% (CAS 875664-36-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033834-1G |
| cas | 875664-36-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 206.20 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 25g | 1060.06 Pln | |
| Fluorochem | 100g | 3106.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-3-fluoro-2-methoxy-5-nitrobenzene (CAS 875664-36-1) is a chemical compound with the molecular formula C7H5BrFNO3 and a molecular weight of 250.02 g/mol. IUPAC name: 1-bromo-3-fluoro-2-methoxy-5-nitrobenzene. InChIKey: FNJMNFQCIBHJBZ-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO3 |
|---|---|
| Molecular weight | 250.02 g/mol |
| IUPAC name | 1-bromo-3-fluoro-2-methoxy-5-nitrobenzene |
| InChIKey | FNJMNFQCIBHJBZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)[N+](=O)[O-])F |
Computed by PubChem (NCBI)