2-Bromo-6-methylquinoline, 97%
cas: 302939-86-2 — see every product listed under this CAS number, including other names
2-Bromo-6-methylquinoline, 97% (CAS 302939-86-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A252155-250mg |
| cas | 302939-86-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 309.19 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Ambeed | 5g | 1549.62 Pln | |
| Chemat | 250mg | 285.20 Pln | |
| Chemat | 1g | 467.60 Pln | |
| Chemat | 5g | 1302.80 Pln | |
| BLDpharm | 250mg | 325.47 Pln | |
| BLDpharm | 1g | 580.93 Pln | |
| BLDpharm | 5g | 1669.44 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 851.80 Pln | |
| Fluorochem | 5g | 2418.96 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-6-methylquinoline (CAS 302939-86-2) is a chemical compound with the molecular formula C10H8BrN and a molecular weight of 222.08 g/mol. IUPAC name: 2-bromo-6-methylquinoline. InChIKey: PFRRWCLQPTZNCN-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN |
|---|---|
| Molecular weight | 222.08 g/mol |
| IUPAC name | 2-bromo-6-methylquinoline |
| InChIKey | PFRRWCLQPTZNCN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(C=C2)Br |
Computed by PubChem (NCBI)