2-Bromo-6-trifluoromethylpyrazine, 95%
cas: 1197237-95-8 — see every product listed under this CAS number, including other names
2-Bromo-6-trifluoromethylpyrazine, 95% (CAS 1197237-95-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F075801-50MG |
| cas | 1197237-95-8 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 456.11 Pln | |
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 1346.42 Pln | |
| Fluorochem | 500mg | 2533.50 Pln | |
| Fluorochem | 1g | 3168.69 Pln | |
| Fluorochem | 2.5g | 7844.13 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-6-(trifluoromethyl)pyrazine (CAS 1197237-95-8) is a chemical compound with the molecular formula C5H2BrF3N2 and a molecular weight of 226.98 g/mol. IUPAC name: 2-bromo-6-(trifluoromethyl)pyrazine. InChIKey: HUCJZLJSTLNVJK-UHFFFAOYSA-N.
| Molecular formula | C5H2BrF3N2 |
|---|---|
| Molecular weight | 226.98 g/mol |
| IUPAC name | 2-bromo-6-(trifluoromethyl)pyrazine |
| InChIKey | HUCJZLJSTLNVJK-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C=N1)Br)C(F)(F)F |
Computed by PubChem (NCBI)