cas: 187746-76-5 — see every product listed under this CAS number, including other names
2-Bromo-7-methylnaphthalene, ≥95%, ≥95% (CAS 187746-76-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GH6-50mg |
| cas | 187746-76-5 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 424.40 Pln | |
| Chemat | 250mg | 1398.80 Pln | |
| Chemat | 1g | 4000.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-7-methylnaphthalene (CAS 187746-76-5) is a chemical compound with the molecular formula C11H9Br and a molecular weight of 221.09 g/mol. IUPAC name: 2-bromo-7-methylnaphthalene. InChIKey: QPVFMEFJFFQONP-UHFFFAOYSA-N.
| Molecular formula | C11H9Br |
|---|---|
| Molecular weight | 221.09 g/mol |
| IUPAC name | 2-bromo-7-methylnaphthalene |
| InChIKey | QPVFMEFJFFQONP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=CC(=C2)Br |
Computed by PubChem (NCBI)