cas: 1784176-25-5 — see every product listed under this CAS number, including other names
2-Bromo-8-chloro-[1,2,4]triazolo[1,5-a]pyridine 97% (CAS 1784176-25-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A614377-100mg |
| cas | 1784176-25-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 581.75 Pln | |
| Ambeed | 250mg | 943.31 Pln | |
| Ambeed | 1g | 2456.31 Pln | |
| Ambeed | 5g | 7240.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A614377 |
2-bromo-8-chloro-[1,2,4]triazolo[1,5-a]pyridine (CAS 1784176-25-5) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 2-bromo-8-chloro-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: CQJRTZCZDYDQPO-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 2-bromo-8-chloro-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | CQJRTZCZDYDQPO-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)Br)C(=C1)Cl |
Computed by PubChem (NCBI)