cas: 957066-13-6 — see every product listed under this CAS number, including other names
2-Bromomethyl-4-trifluoromethoxyphenylboronic acid, pinacol ester, 98%, 98% (CAS 957066-13-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GS4-100mg |
| cas | 957066-13-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 458.00 Pln | |
| Chemat | 250mg | 813.20 Pln | |
| Chemat | 1g | 2090.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-(bromomethyl)-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 957066-13-6) is a chemical compound with the molecular formula C14H17BBrF3O3 and a molecular weight of 380.99 g/mol. IUPAC name: 2-[2-(bromomethyl)-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: CJXUOEJTOXQAMB-UHFFFAOYSA-N.
| Molecular formula | C14H17BBrF3O3 |
|---|---|
| Molecular weight | 380.99 g/mol |
| IUPAC name | 2-[2-(bromomethyl)-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | CJXUOEJTOXQAMB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC(F)(F)F)CBr |
Computed by PubChem (NCBI)