cas: 1030832-46-2 — see every product listed under this CAS number, including other names
2-Bromomethyl-4-trifluoromethylphenylboronic acid, pinacol ester, 98%, 98% (CAS 1030832-46-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11H0YH-1g |
| cas | 1030832-46-2 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 280.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1030832-46-2) is a chemical compound with the molecular formula C14H17BBrF3O2 and a molecular weight of 365.00 g/mol. IUPAC name: 2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JZOSNWGJPQXMMC-UHFFFAOYSA-N.
| Molecular formula | C14H17BBrF3O2 |
|---|---|
| Molecular weight | 365.00 g/mol |
| IUPAC name | 2-[2-(bromomethyl)-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JZOSNWGJPQXMMC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(F)(F)F)CBr |
Computed by PubChem (NCBI)